N~3~-(4-methoxybenzene-1-sulfonyl)-N-(2-phenylethyl)-beta-alaninamide
Chemical Structure Depiction of
N~3~-(4-methoxybenzene-1-sulfonyl)-N-(2-phenylethyl)-beta-alaninamide
N~3~-(4-methoxybenzene-1-sulfonyl)-N-(2-phenylethyl)-beta-alaninamide
Compound characteristics
| Compound ID: | K781-2269 |
| Compound Name: | N~3~-(4-methoxybenzene-1-sulfonyl)-N-(2-phenylethyl)-beta-alaninamide |
| Molecular Weight: | 362.45 |
| Molecular Formula: | C18 H22 N2 O4 S |
| Smiles: | COc1ccc(cc1)S(NCCC(NCCc1ccccc1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9763 |
| logD: | 1.9763 |
| logSw: | -2.6007 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.695 |
| InChI Key: | HQKBFBIPOZUVCX-UHFFFAOYSA-N |