3-{[(2-chlorophenyl)methyl]sulfamoyl}-N-(2-ethoxyphenyl)-4-fluorobenzamide
Chemical Structure Depiction of
3-{[(2-chlorophenyl)methyl]sulfamoyl}-N-(2-ethoxyphenyl)-4-fluorobenzamide
3-{[(2-chlorophenyl)methyl]sulfamoyl}-N-(2-ethoxyphenyl)-4-fluorobenzamide
Compound characteristics
| Compound ID: | K781-6835 |
| Compound Name: | 3-{[(2-chlorophenyl)methyl]sulfamoyl}-N-(2-ethoxyphenyl)-4-fluorobenzamide |
| Molecular Weight: | 462.93 |
| Molecular Formula: | C22 H20 Cl F N2 O4 S |
| Smiles: | CCOc1ccccc1NC(c1ccc(c(c1)S(NCc1ccccc1[Cl])(=O)=O)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0035 |
| logD: | 4.9378 |
| logSw: | -5.2313 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.6 |
| InChI Key: | ITKOEMYCRWAHGM-UHFFFAOYSA-N |