N-(3-chloro-2-methylphenyl)-2-fluoro-5-{[(4-methoxyphenyl)methyl]sulfamoyl}benzamide
Chemical Structure Depiction of
N-(3-chloro-2-methylphenyl)-2-fluoro-5-{[(4-methoxyphenyl)methyl]sulfamoyl}benzamide
N-(3-chloro-2-methylphenyl)-2-fluoro-5-{[(4-methoxyphenyl)methyl]sulfamoyl}benzamide
Compound characteristics
| Compound ID: | K781-7048 |
| Compound Name: | N-(3-chloro-2-methylphenyl)-2-fluoro-5-{[(4-methoxyphenyl)methyl]sulfamoyl}benzamide |
| Molecular Weight: | 462.93 |
| Molecular Formula: | C22 H20 Cl F N2 O4 S |
| Smiles: | Cc1c(cccc1[Cl])NC(c1cc(ccc1F)S(NCc1ccc(cc1)OC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9492 |
| logD: | 4.693 |
| logSw: | -5.0298 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.934 |
| InChI Key: | GJIYKNDJFFYFDX-UHFFFAOYSA-N |