N-(2-ethylphenyl)-4-{[(4-fluorophenyl)methyl]amino}-3-nitrobenzamide
Chemical Structure Depiction of
N-(2-ethylphenyl)-4-{[(4-fluorophenyl)methyl]amino}-3-nitrobenzamide
N-(2-ethylphenyl)-4-{[(4-fluorophenyl)methyl]amino}-3-nitrobenzamide
Compound characteristics
| Compound ID: | K781-7150 |
| Compound Name: | N-(2-ethylphenyl)-4-{[(4-fluorophenyl)methyl]amino}-3-nitrobenzamide |
| Molecular Weight: | 393.42 |
| Molecular Formula: | C22 H20 F N3 O3 |
| Smiles: | CCc1ccccc1NC(c1ccc(c(c1)[N+]([O-])=O)NCc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9428 |
| logD: | 4.9419 |
| logSw: | -4.6462 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.249 |
| InChI Key: | TXXHIOHPHHBEIA-UHFFFAOYSA-N |