N-(2,4-dichlorophenyl)-2-fluoro-5-(piperidine-1-sulfonyl)benzamide
Chemical Structure Depiction of
N-(2,4-dichlorophenyl)-2-fluoro-5-(piperidine-1-sulfonyl)benzamide
N-(2,4-dichlorophenyl)-2-fluoro-5-(piperidine-1-sulfonyl)benzamide
Compound characteristics
| Compound ID: | K781-7849 |
| Compound Name: | N-(2,4-dichlorophenyl)-2-fluoro-5-(piperidine-1-sulfonyl)benzamide |
| Molecular Weight: | 431.31 |
| Molecular Formula: | C18 H17 Cl2 F N2 O3 S |
| Smiles: | C1CCN(CC1)S(c1ccc(c(c1)C(Nc1ccc(cc1[Cl])[Cl])=O)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5904 |
| logD: | 3.1064 |
| logSw: | -4.6697 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.343 |
| InChI Key: | MNFOUQALIYUPNJ-UHFFFAOYSA-N |