3-[ethyl(3-methylphenyl)sulfamoyl]-N-(2-ethylphenyl)-4-fluorobenzamide
Chemical Structure Depiction of
3-[ethyl(3-methylphenyl)sulfamoyl]-N-(2-ethylphenyl)-4-fluorobenzamide
3-[ethyl(3-methylphenyl)sulfamoyl]-N-(2-ethylphenyl)-4-fluorobenzamide
Compound characteristics
| Compound ID: | K781-8019 |
| Compound Name: | 3-[ethyl(3-methylphenyl)sulfamoyl]-N-(2-ethylphenyl)-4-fluorobenzamide |
| Molecular Weight: | 440.54 |
| Molecular Formula: | C24 H25 F N2 O3 S |
| Smiles: | CCc1ccccc1NC(c1ccc(c(c1)S(N(CC)c1cccc(C)c1)(=O)=O)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.515 |
| logD: | 5.5139 |
| logSw: | -5.4517 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.182 |
| InChI Key: | MGZQKNWCTMXHJF-UHFFFAOYSA-N |