N-(3-chlorophenyl)-2-fluoro-5-{[(4-methylphenyl)methyl]sulfamoyl}benzamide
Chemical Structure Depiction of
N-(3-chlorophenyl)-2-fluoro-5-{[(4-methylphenyl)methyl]sulfamoyl}benzamide
N-(3-chlorophenyl)-2-fluoro-5-{[(4-methylphenyl)methyl]sulfamoyl}benzamide
Compound characteristics
| Compound ID: | K781-8401 |
| Compound Name: | N-(3-chlorophenyl)-2-fluoro-5-{[(4-methylphenyl)methyl]sulfamoyl}benzamide |
| Molecular Weight: | 432.9 |
| Molecular Formula: | C21 H18 Cl F N2 O3 S |
| Smiles: | Cc1ccc(CNS(c2ccc(c(c2)C(Nc2cccc(c2)[Cl])=O)F)(=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.1382 |
| logD: | 4.9727 |
| logSw: | -5.3453 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.088 |
| InChI Key: | LOAIKQPHHHKNDD-UHFFFAOYSA-N |