N-(2-bromo-4,6-difluorophenyl)-2-fluoro-5-{[(4-methoxyphenyl)methyl]sulfamoyl}benzamide
Chemical Structure Depiction of
N-(2-bromo-4,6-difluorophenyl)-2-fluoro-5-{[(4-methoxyphenyl)methyl]sulfamoyl}benzamide
N-(2-bromo-4,6-difluorophenyl)-2-fluoro-5-{[(4-methoxyphenyl)methyl]sulfamoyl}benzamide
Compound characteristics
| Compound ID: | K781-8877 |
| Compound Name: | N-(2-bromo-4,6-difluorophenyl)-2-fluoro-5-{[(4-methoxyphenyl)methyl]sulfamoyl}benzamide |
| Molecular Weight: | 529.33 |
| Molecular Formula: | C21 H16 Br F3 N2 O4 S |
| Smiles: | COc1ccc(CNS(c2ccc(c(c2)C(Nc2c(cc(cc2[Br])F)F)=O)F)(=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.2316 |
| logD: | 1.7846 |
| logSw: | -4.3298 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.236 |
| InChI Key: | RRBSHJWUDXECAK-UHFFFAOYSA-N |