N-(3,5-dichlorophenyl)-2-fluoro-5-[4-(4-methoxyphenyl)piperazine-1-sulfonyl]benzamide
					Chemical Structure Depiction of
N-(3,5-dichlorophenyl)-2-fluoro-5-[4-(4-methoxyphenyl)piperazine-1-sulfonyl]benzamide
			N-(3,5-dichlorophenyl)-2-fluoro-5-[4-(4-methoxyphenyl)piperazine-1-sulfonyl]benzamide
Compound characteristics
| Compound ID: | K781-9046 | 
| Compound Name: | N-(3,5-dichlorophenyl)-2-fluoro-5-[4-(4-methoxyphenyl)piperazine-1-sulfonyl]benzamide | 
| Molecular Weight: | 538.42 | 
| Molecular Formula: | C24 H22 Cl2 F N3 O4 S | 
| Smiles: | COc1ccc(cc1)N1CCN(CC1)S(c1ccc(c(c1)C(Nc1cc(cc(c1)[Cl])[Cl])=O)F)(=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 5.8064 | 
| logD: | 4.2488 | 
| logSw: | -5.9801 | 
| Hydrogen bond acceptors count: | 8 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 65.845 | 
| InChI Key: | UZAQYPFJCRLBSW-UHFFFAOYSA-N | 
 
				 
				