5-(cyclohexylsulfamoyl)-N-(3,4-dimethylphenyl)-2-fluorobenzamide
Chemical Structure Depiction of
5-(cyclohexylsulfamoyl)-N-(3,4-dimethylphenyl)-2-fluorobenzamide
5-(cyclohexylsulfamoyl)-N-(3,4-dimethylphenyl)-2-fluorobenzamide
Compound characteristics
| Compound ID: | K781-9300 |
| Compound Name: | 5-(cyclohexylsulfamoyl)-N-(3,4-dimethylphenyl)-2-fluorobenzamide |
| Molecular Weight: | 404.5 |
| Molecular Formula: | C21 H25 F N2 O3 S |
| Smiles: | Cc1ccc(cc1C)NC(c1cc(ccc1F)S(NC1CCCCC1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3393 |
| logD: | 5.337 |
| logSw: | -5.2312 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.027 |
| InChI Key: | DXRQSBVLAPMPBR-UHFFFAOYSA-N |