5-[ethyl(phenyl)sulfamoyl]-2-fluoro-N-[4-(propan-2-yl)phenyl]benzamide
Chemical Structure Depiction of
5-[ethyl(phenyl)sulfamoyl]-2-fluoro-N-[4-(propan-2-yl)phenyl]benzamide
5-[ethyl(phenyl)sulfamoyl]-2-fluoro-N-[4-(propan-2-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | K781-9623 |
| Compound Name: | 5-[ethyl(phenyl)sulfamoyl]-2-fluoro-N-[4-(propan-2-yl)phenyl]benzamide |
| Molecular Weight: | 440.54 |
| Molecular Formula: | C24 H25 F N2 O3 S |
| Smiles: | CCN(c1ccccc1)S(c1ccc(c(c1)C(Nc1ccc(cc1)C(C)C)=O)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6609 |
| logD: | 5.6584 |
| logSw: | -5.4314 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.88 |
| InChI Key: | DCSHDKRCPWATNE-UHFFFAOYSA-N |