N-cycloheptyl-4-{[(4-methoxybenzene-1-sulfonyl)amino]methyl}benzamide
Chemical Structure Depiction of
N-cycloheptyl-4-{[(4-methoxybenzene-1-sulfonyl)amino]methyl}benzamide
N-cycloheptyl-4-{[(4-methoxybenzene-1-sulfonyl)amino]methyl}benzamide
Compound characteristics
| Compound ID: | K783-0101 |
| Compound Name: | N-cycloheptyl-4-{[(4-methoxybenzene-1-sulfonyl)amino]methyl}benzamide |
| Molecular Weight: | 416.54 |
| Molecular Formula: | C22 H28 N2 O4 S |
| Smiles: | COc1ccc(cc1)S(NCc1ccc(cc1)C(NC1CCCCCC1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2021 |
| logD: | 4.202 |
| logSw: | -4.1884 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.01 |
| InChI Key: | DAZNXONEVWAZAH-UHFFFAOYSA-N |