4-{[(4-methoxybenzene-1-sulfonyl)amino]methyl}-N-octylbenzamide
Chemical Structure Depiction of
4-{[(4-methoxybenzene-1-sulfonyl)amino]methyl}-N-octylbenzamide
4-{[(4-methoxybenzene-1-sulfonyl)amino]methyl}-N-octylbenzamide
Compound characteristics
| Compound ID: | K783-0107 |
| Compound Name: | 4-{[(4-methoxybenzene-1-sulfonyl)amino]methyl}-N-octylbenzamide |
| Molecular Weight: | 432.58 |
| Molecular Formula: | C23 H32 N2 O4 S |
| Smiles: | CCCCCCCCNC(c1ccc(CNS(c2ccc(cc2)OC)(=O)=O)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1027 |
| logD: | 5.1026 |
| logSw: | -4.7987 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.067 |
| InChI Key: | VLRGTEJDHNRFJV-UHFFFAOYSA-N |