N-(2,2-dimethoxyethyl)-1-(3-methylphenyl)-1H-benzimidazole-5-carboxamide
Chemical Structure Depiction of
N-(2,2-dimethoxyethyl)-1-(3-methylphenyl)-1H-benzimidazole-5-carboxamide
N-(2,2-dimethoxyethyl)-1-(3-methylphenyl)-1H-benzimidazole-5-carboxamide
Compound characteristics
| Compound ID: | K783-0288 |
| Compound Name: | N-(2,2-dimethoxyethyl)-1-(3-methylphenyl)-1H-benzimidazole-5-carboxamide |
| Molecular Weight: | 339.39 |
| Molecular Formula: | C19 H21 N3 O3 |
| Smiles: | Cc1cccc(c1)n1cnc2cc(ccc12)C(NCC(OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1773 |
| logD: | 2.161 |
| logSw: | -2.6368 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.062 |
| InChI Key: | LNAHLWOKARFOON-UHFFFAOYSA-N |