ethyl 4-{[benzyl(4-methylbenzene-1-sulfonyl)amino]methyl}benzoate
Chemical Structure Depiction of
ethyl 4-{[benzyl(4-methylbenzene-1-sulfonyl)amino]methyl}benzoate
ethyl 4-{[benzyl(4-methylbenzene-1-sulfonyl)amino]methyl}benzoate
Compound characteristics
| Compound ID: | K783-0677 |
| Compound Name: | ethyl 4-{[benzyl(4-methylbenzene-1-sulfonyl)amino]methyl}benzoate |
| Molecular Weight: | 423.53 |
| Molecular Formula: | C24 H25 N O4 S |
| Smiles: | CCOC(c1ccc(CN(Cc2ccccc2)S(c2ccc(C)cc2)(=O)=O)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6321 |
| logD: | 5.6321 |
| logSw: | -5.4998 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 52.096 |
| InChI Key: | RUBNEWPXVATQID-UHFFFAOYSA-N |