methyl 2-cyano-3-[(6-methylpyridin-2-yl)amino]prop-2-enoate
Chemical Structure Depiction of
methyl 2-cyano-3-[(6-methylpyridin-2-yl)amino]prop-2-enoate
methyl 2-cyano-3-[(6-methylpyridin-2-yl)amino]prop-2-enoate
Compound characteristics
| Compound ID: | K783-3270 |
| Compound Name: | methyl 2-cyano-3-[(6-methylpyridin-2-yl)amino]prop-2-enoate |
| Molecular Weight: | 217.22 |
| Molecular Formula: | C11 H11 N3 O2 |
| Smiles: | Cc1cccc(N/C=C(/C#N)C(=O)OC)n1 |
| Stereo: | ACHIRAL |
| logP: | 1.6756 |
| logD: | 1.121 |
| logSw: | -1.8446 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.059 |
| InChI Key: | UWKKBSXZXIQQDZ-UHFFFAOYSA-N |