methyl 3-[(4-chlorophenyl)carbamamido]-4-(4-methylpiperidin-1-yl)benzoate
Chemical Structure Depiction of
methyl 3-[(4-chlorophenyl)carbamamido]-4-(4-methylpiperidin-1-yl)benzoate
methyl 3-[(4-chlorophenyl)carbamamido]-4-(4-methylpiperidin-1-yl)benzoate
Compound characteristics
| Compound ID: | K783-4553 |
| Compound Name: | methyl 3-[(4-chlorophenyl)carbamamido]-4-(4-methylpiperidin-1-yl)benzoate |
| Molecular Weight: | 401.89 |
| Molecular Formula: | C21 H24 Cl N3 O3 |
| Smiles: | CC1CCN(CC1)c1ccc(cc1NC(Nc1ccc(cc1)[Cl])=O)C(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 5.7453 |
| logD: | 5.7445 |
| logSw: | -6.0874 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.169 |
| InChI Key: | CXIGVQPCVPKKIE-UHFFFAOYSA-N |