ethyl {2-[(3-chlorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate
Chemical Structure Depiction of
ethyl {2-[(3-chlorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate
ethyl {2-[(3-chlorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate
Compound characteristics
| Compound ID: | K783-5247 |
| Compound Name: | ethyl {2-[(3-chlorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate |
| Molecular Weight: | 373.86 |
| Molecular Formula: | C19 H16 Cl N O3 S |
| Smiles: | CCOC(CN1C(/C(=C/c2cccc(c2)[Cl])Sc2ccccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6154 |
| logD: | 4.6154 |
| logSw: | -4.5153 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 35.5 |
| InChI Key: | HOHIRDDUJNYFAY-UHFFFAOYSA-N |