N'-(3-ethylphenyl)-N-[(1-methyl-1H-indol-3-yl)methyl]-N-[3-(morpholin-4-yl)propyl]thiourea
Chemical Structure Depiction of
N'-(3-ethylphenyl)-N-[(1-methyl-1H-indol-3-yl)methyl]-N-[3-(morpholin-4-yl)propyl]thiourea
N'-(3-ethylphenyl)-N-[(1-methyl-1H-indol-3-yl)methyl]-N-[3-(morpholin-4-yl)propyl]thiourea
Compound characteristics
| Compound ID: | K783-5569 |
| Compound Name: | N'-(3-ethylphenyl)-N-[(1-methyl-1H-indol-3-yl)methyl]-N-[3-(morpholin-4-yl)propyl]thiourea |
| Molecular Weight: | 450.65 |
| Molecular Formula: | C26 H34 N4 O S |
| Smiles: | CCc1cccc(c1)NC(N(CCCN1CCOCC1)Cc1cn(C)c2ccccc12)=S |
| Stereo: | ACHIRAL |
| logP: | 4.7817 |
| logD: | 4.6294 |
| logSw: | -4.6015 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.8569 |
| InChI Key: | PTQUKEMKPPVGSF-UHFFFAOYSA-N |