N-(5-chloro-2-methoxyphenyl)-5-(cycloheptylsulfamoyl)-2-fluorobenzamide
Chemical Structure Depiction of
N-(5-chloro-2-methoxyphenyl)-5-(cycloheptylsulfamoyl)-2-fluorobenzamide
N-(5-chloro-2-methoxyphenyl)-5-(cycloheptylsulfamoyl)-2-fluorobenzamide
Compound characteristics
| Compound ID: | K784-0145 |
| Compound Name: | N-(5-chloro-2-methoxyphenyl)-5-(cycloheptylsulfamoyl)-2-fluorobenzamide |
| Molecular Weight: | 454.95 |
| Molecular Formula: | C21 H24 Cl F N2 O4 S |
| Smiles: | COc1ccc(cc1NC(c1cc(ccc1F)S(NC1CCCCCC1)(=O)=O)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.2989 |
| logD: | 4.1542 |
| logSw: | -5.759 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.29 |
| InChI Key: | WQDMMQULYZRSHV-UHFFFAOYSA-N |