N-[2-(4-chlorophenyl)ethyl]-2-{[(2-methylphenyl)methyl]sulfanyl}acetamide
Chemical Structure Depiction of
N-[2-(4-chlorophenyl)ethyl]-2-{[(2-methylphenyl)methyl]sulfanyl}acetamide
N-[2-(4-chlorophenyl)ethyl]-2-{[(2-methylphenyl)methyl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | K784-0969 |
| Compound Name: | N-[2-(4-chlorophenyl)ethyl]-2-{[(2-methylphenyl)methyl]sulfanyl}acetamide |
| Molecular Weight: | 333.88 |
| Molecular Formula: | C18 H20 Cl N O S |
| Smiles: | Cc1ccccc1CSCC(NCCc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.6295 |
| logD: | 4.6295 |
| logSw: | -4.7397 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.2798 |
| InChI Key: | VADUOQKEUPFGOE-UHFFFAOYSA-N |