N-(2,2-diethoxyethyl)-6-[(2-ethylphenyl)(methyl)sulfamoyl]-4-oxo-1,4-dihydroquinoline-3-carboxamide
Chemical Structure Depiction of
N-(2,2-diethoxyethyl)-6-[(2-ethylphenyl)(methyl)sulfamoyl]-4-oxo-1,4-dihydroquinoline-3-carboxamide
N-(2,2-diethoxyethyl)-6-[(2-ethylphenyl)(methyl)sulfamoyl]-4-oxo-1,4-dihydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | K784-1363 |
| Compound Name: | N-(2,2-diethoxyethyl)-6-[(2-ethylphenyl)(methyl)sulfamoyl]-4-oxo-1,4-dihydroquinoline-3-carboxamide |
| Molecular Weight: | 501.6 |
| Molecular Formula: | C25 H31 N3 O6 S |
| Smiles: | CCc1ccccc1N(C)S(c1ccc2c(c1)C(C(=CN2)C(NCC(OCC)OCC)=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.108 |
| logD: | 2.047 |
| logSw: | -3.7975 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 96.217 |
| InChI Key: | VOLGCVXJCWHEHZ-UHFFFAOYSA-N |