4-[(3-cycloheptylpropyl)amino]-N-(3-methylphenyl)-3-nitrobenzamide
Chemical Structure Depiction of
4-[(3-cycloheptylpropyl)amino]-N-(3-methylphenyl)-3-nitrobenzamide
4-[(3-cycloheptylpropyl)amino]-N-(3-methylphenyl)-3-nitrobenzamide
Compound characteristics
| Compound ID: | K784-1416 |
| Compound Name: | 4-[(3-cycloheptylpropyl)amino]-N-(3-methylphenyl)-3-nitrobenzamide |
| Molecular Weight: | 409.53 |
| Molecular Formula: | C24 H31 N3 O3 |
| Smiles: | Cc1cccc(c1)NC(c1ccc(c(c1)[N+]([O-])=O)NCCCC1CCCCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.5952 |
| logD: | 6.5942 |
| logSw: | -5.5056 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.312 |
| InChI Key: | SLIFMLFPTRPBPJ-UHFFFAOYSA-N |