4-({3-[4-(3-chlorophenyl)piperazin-1-yl]propyl}amino)-3-nitro-N-[4-(propan-2-yl)phenyl]benzamide
Chemical Structure Depiction of
4-({3-[4-(3-chlorophenyl)piperazin-1-yl]propyl}amino)-3-nitro-N-[4-(propan-2-yl)phenyl]benzamide
4-({3-[4-(3-chlorophenyl)piperazin-1-yl]propyl}amino)-3-nitro-N-[4-(propan-2-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | K784-1435 |
| Compound Name: | 4-({3-[4-(3-chlorophenyl)piperazin-1-yl]propyl}amino)-3-nitro-N-[4-(propan-2-yl)phenyl]benzamide |
| Molecular Weight: | 536.07 |
| Molecular Formula: | C29 H34 Cl N5 O3 |
| Smiles: | CC(C)c1ccc(cc1)NC(c1ccc(c(c1)[N+]([O-])=O)NCCCN1CCN(CC1)c1cccc(c1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.3496 |
| logD: | 6.1483 |
| logSw: | -6.4295 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.031 |
| InChI Key: | LHLWSPMRGXFJLC-UHFFFAOYSA-N |