3-[(4-acetamidobenzene-1-sulfonyl)amino]-N-hexyl-4-methylpentanamide
Chemical Structure Depiction of
3-[(4-acetamidobenzene-1-sulfonyl)amino]-N-hexyl-4-methylpentanamide
3-[(4-acetamidobenzene-1-sulfonyl)amino]-N-hexyl-4-methylpentanamide
Compound characteristics
| Compound ID: | K784-1639 |
| Compound Name: | 3-[(4-acetamidobenzene-1-sulfonyl)amino]-N-hexyl-4-methylpentanamide |
| Molecular Weight: | 411.56 |
| Molecular Formula: | C20 H33 N3 O4 S |
| Smiles: | CCCCCCNC(CC(C(C)C)NS(c1ccc(cc1)NC(C)=O)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.075 |
| logD: | 3.0746 |
| logSw: | -3.2858 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 89.687 |
| InChI Key: | UISVHLGFWWSNTN-IBGZPJMESA-N |