2-{[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(4-bromophenyl)acetamide
Chemical Structure Depiction of
2-{[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(4-bromophenyl)acetamide
2-{[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(4-bromophenyl)acetamide
Compound characteristics
| Compound ID: | K784-2150 |
| Compound Name: | 2-{[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(4-bromophenyl)acetamide |
| Molecular Weight: | 537.43 |
| Molecular Formula: | C25 H21 Br N4 O3 S |
| Smiles: | COc1ccc(cc1)c1c(c2ccc(cc2)OC)nnc(n1)SCC(Nc1ccc(cc1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 5.4317 |
| logD: | 5.4316 |
| logSw: | -5.3973 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.622 |
| InChI Key: | RVJSJJBCEHDKLK-UHFFFAOYSA-N |