2-{[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(4-ethoxyphenyl)acetamide
Chemical Structure Depiction of
2-{[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(4-ethoxyphenyl)acetamide
2-{[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(4-ethoxyphenyl)acetamide
Compound characteristics
| Compound ID: | K784-2882 |
| Compound Name: | 2-{[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(4-ethoxyphenyl)acetamide |
| Molecular Weight: | 470.59 |
| Molecular Formula: | C27 H26 N4 O2 S |
| Smiles: | CCOc1ccc(cc1)NC(CSc1nc(c2ccc(C)cc2)c(c2ccc(C)cc2)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8487 |
| logD: | 5.8487 |
| logSw: | -5.4117 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.658 |
| InChI Key: | JDQDFTUYNIDJNX-UHFFFAOYSA-N |