2-chloro-N-[1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-[(3-methoxyphenyl)methyl]acetamide
Chemical Structure Depiction of
2-chloro-N-[1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-[(3-methoxyphenyl)methyl]acetamide
2-chloro-N-[1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-[(3-methoxyphenyl)methyl]acetamide
Compound characteristics
| Compound ID: | K784-3607 |
| Compound Name: | 2-chloro-N-[1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-[(3-methoxyphenyl)methyl]acetamide |
| Molecular Weight: | 463.4 |
| Molecular Formula: | C24 H28 Cl2 N2 O3 |
| Smiles: | COc1cccc(CN(C(C(NC2CCCCC2)=O)c2ccc(cc2)[Cl])C(C[Cl])=O)c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9461 |
| logD: | 4.9461 |
| logSw: | -5.2289 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.589 |
| InChI Key: | BJVVPTPIGVDTQD-HSZRJFAPSA-N |