N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-chloro-N-[1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]acetamide
Chemical Structure Depiction of
N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-chloro-N-[1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]acetamide
N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-chloro-N-[1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]acetamide
Compound characteristics
| Compound ID: | K784-3618 |
| Compound Name: | N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-chloro-N-[1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]acetamide |
| Molecular Weight: | 477.39 |
| Molecular Formula: | C24 H26 Cl2 N2 O4 |
| Smiles: | C1CCC(CC1)NC(C(c1ccc(cc1)[Cl])N(Cc1ccc2c(c1)OCO2)C(C[Cl])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7619 |
| logD: | 4.7619 |
| logSw: | -5.137 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.16 |
| InChI Key: | ODVZOGNJGHFSOK-HSZRJFAPSA-N |