N-[2-(4-chlorophenyl)ethyl]-N~2~-{cyclopentyl[(thiophen-2-yl)methyl]carbamothioyl}glycinamide
Chemical Structure Depiction of
N-[2-(4-chlorophenyl)ethyl]-N~2~-{cyclopentyl[(thiophen-2-yl)methyl]carbamothioyl}glycinamide
N-[2-(4-chlorophenyl)ethyl]-N~2~-{cyclopentyl[(thiophen-2-yl)methyl]carbamothioyl}glycinamide
Compound characteristics
| Compound ID: | K784-3969 |
| Compound Name: | N-[2-(4-chlorophenyl)ethyl]-N~2~-{cyclopentyl[(thiophen-2-yl)methyl]carbamothioyl}glycinamide |
| Molecular Weight: | 436.04 |
| Molecular Formula: | C21 H26 Cl N3 O S2 |
| Smiles: | C1CCC(C1)N(Cc1cccs1)C(NCC(NCCc1ccc(cc1)[Cl])=O)=S |
| Stereo: | ACHIRAL |
| logP: | 4.6213 |
| logD: | 4.6213 |
| logSw: | -4.9063 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 36.692 |
| InChI Key: | OGUPWQTTWAXMKZ-UHFFFAOYSA-N |