ethyl 4-[([(4-bromophenyl)methyl]{4-fluoro-3-[(3-fluorophenyl)carbamoyl]benzene-1-sulfonyl}amino)methyl]benzoate
					Chemical Structure Depiction of
ethyl 4-[([(4-bromophenyl)methyl]{4-fluoro-3-[(3-fluorophenyl)carbamoyl]benzene-1-sulfonyl}amino)methyl]benzoate
			ethyl 4-[([(4-bromophenyl)methyl]{4-fluoro-3-[(3-fluorophenyl)carbamoyl]benzene-1-sulfonyl}amino)methyl]benzoate
Compound characteristics
| Compound ID: | K784-4098 | 
| Compound Name: | ethyl 4-[([(4-bromophenyl)methyl]{4-fluoro-3-[(3-fluorophenyl)carbamoyl]benzene-1-sulfonyl}amino)methyl]benzoate | 
| Molecular Weight: | 643.5 | 
| Molecular Formula: | C30 H25 Br F2 N2 O5 S | 
| Smiles: | CCOC(c1ccc(CN(Cc2ccc(cc2)[Br])S(c2ccc(c(c2)C(Nc2cccc(c2)F)=O)F)(=O)=O)cc1)=O | 
| Stereo: | ACHIRAL | 
| logP: | 7.3594 | 
| logD: | 7.1938 | 
| logSw: | -5.7218 | 
| Hydrogen bond acceptors count: | 10 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 75.187 | 
| InChI Key: | UCEAQTGWOMVGIL-UHFFFAOYSA-N | 
 
				 
				