N-cyclohexyl-N-[(2-fluorophenyl)methyl]-N'-(3-methoxyphenyl)thiourea
Chemical Structure Depiction of
N-cyclohexyl-N-[(2-fluorophenyl)methyl]-N'-(3-methoxyphenyl)thiourea
N-cyclohexyl-N-[(2-fluorophenyl)methyl]-N'-(3-methoxyphenyl)thiourea
Compound characteristics
| Compound ID: | K784-4264 |
| Compound Name: | N-cyclohexyl-N-[(2-fluorophenyl)methyl]-N'-(3-methoxyphenyl)thiourea |
| Molecular Weight: | 372.5 |
| Molecular Formula: | C21 H25 F N2 O S |
| Smiles: | COc1cccc(c1)NC(N(Cc1ccccc1F)C1CCCCC1)=S |
| Stereo: | ACHIRAL |
| logP: | 6.0685 |
| logD: | 6.0685 |
| logSw: | -5.5119 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 17.2163 |
| InChI Key: | MSNURCAEZWIKBZ-UHFFFAOYSA-N |