1,4-dicyclohexyl-3-(4-methylphenyl)piperazine-2,5-dione
Chemical Structure Depiction of
1,4-dicyclohexyl-3-(4-methylphenyl)piperazine-2,5-dione
1,4-dicyclohexyl-3-(4-methylphenyl)piperazine-2,5-dione
Compound characteristics
| Compound ID: | K784-4371 |
| Compound Name: | 1,4-dicyclohexyl-3-(4-methylphenyl)piperazine-2,5-dione |
| Molecular Weight: | 368.52 |
| Molecular Formula: | C23 H32 N2 O2 |
| Smiles: | Cc1ccc(cc1)C1C(N(CC(N1C1CCCCC1)=O)C1CCCCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.732 |
| logD: | 4.732 |
| logSw: | -4.4507 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.1692 |
| InChI Key: | PHKXTLMQNRNNHD-QFIPXVFZSA-N |