N-[(furan-2-yl)methyl]-N'-(4-phenoxyphenyl)-N-[(pyridin-3-yl)methyl]thiourea
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-N'-(4-phenoxyphenyl)-N-[(pyridin-3-yl)methyl]thiourea
N-[(furan-2-yl)methyl]-N'-(4-phenoxyphenyl)-N-[(pyridin-3-yl)methyl]thiourea
Compound characteristics
| Compound ID: | K784-4465 |
| Compound Name: | N-[(furan-2-yl)methyl]-N'-(4-phenoxyphenyl)-N-[(pyridin-3-yl)methyl]thiourea |
| Molecular Weight: | 415.51 |
| Molecular Formula: | C24 H21 N3 O2 S |
| Smiles: | C(c1cccnc1)N(Cc1ccco1)C(Nc1ccc(cc1)Oc1ccccc1)=S |
| Stereo: | ACHIRAL |
| logP: | 5.0106 |
| logD: | 5.01 |
| logSw: | -4.5991 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.442 |
| InChI Key: | JNLOUILOGXOTPL-UHFFFAOYSA-N |