N-(3-ethoxypropyl)-2-phenylquinoline-4-carboxamide
Chemical Structure Depiction of
N-(3-ethoxypropyl)-2-phenylquinoline-4-carboxamide
N-(3-ethoxypropyl)-2-phenylquinoline-4-carboxamide
Compound characteristics
| Compound ID: | K784-4615 |
| Compound Name: | N-(3-ethoxypropyl)-2-phenylquinoline-4-carboxamide |
| Molecular Weight: | 334.42 |
| Molecular Formula: | C21 H22 N2 O2 |
| Smiles: | CCOCCCNC(c1cc(c2ccccc2)nc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4101 |
| logD: | 4.4101 |
| logSw: | -4.1788 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.801 |
| InChI Key: | UCXXCHMKRUDYRH-UHFFFAOYSA-N |