4-({[(3,5-dimethylphenyl)carbamothioyl][(2-methylphenyl)methyl]amino}methyl)cyclohexane-1-carboxylic acid
Chemical Structure Depiction of
4-({[(3,5-dimethylphenyl)carbamothioyl][(2-methylphenyl)methyl]amino}methyl)cyclohexane-1-carboxylic acid
4-({[(3,5-dimethylphenyl)carbamothioyl][(2-methylphenyl)methyl]amino}methyl)cyclohexane-1-carboxylic acid
Compound characteristics
| Compound ID: | K784-4893 |
| Compound Name: | 4-({[(3,5-dimethylphenyl)carbamothioyl][(2-methylphenyl)methyl]amino}methyl)cyclohexane-1-carboxylic acid |
| Molecular Weight: | 424.6 |
| Molecular Formula: | C25 H32 N2 O2 S |
| Smiles: | Cc1cc(C)cc(c1)NC(N(CC1CCC(CC1)C(O)=O)Cc1ccccc1C)=S |
| Stereo: | ACHIRAL |
| logP: | 6.1315 |
| logD: | 3.5712 |
| logSw: | -5.3121 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 39.028 |
| InChI Key: | RWNNSYOBNQZFGO-UHFFFAOYSA-N |