2-chloro-N-[2-(cyclohexylamino)-1-(3,4-dimethoxyphenyl)-2-oxoethyl]-N-[(4-fluorophenyl)methyl]acetamide
Chemical Structure Depiction of
2-chloro-N-[2-(cyclohexylamino)-1-(3,4-dimethoxyphenyl)-2-oxoethyl]-N-[(4-fluorophenyl)methyl]acetamide
2-chloro-N-[2-(cyclohexylamino)-1-(3,4-dimethoxyphenyl)-2-oxoethyl]-N-[(4-fluorophenyl)methyl]acetamide
Compound characteristics
| Compound ID: | K784-4967 |
| Compound Name: | 2-chloro-N-[2-(cyclohexylamino)-1-(3,4-dimethoxyphenyl)-2-oxoethyl]-N-[(4-fluorophenyl)methyl]acetamide |
| Molecular Weight: | 476.98 |
| Molecular Formula: | C25 H30 Cl F N2 O4 |
| Smiles: | COc1ccc(cc1OC)C(C(NC1CCCCC1)=O)N(Cc1ccc(cc1)F)C(C[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9877 |
| logD: | 3.9877 |
| logSw: | -4.2065 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.306 |
| InChI Key: | LARUFUUSSOBPRF-XMMPIXPASA-N |