N~2~-{[(2-chlorophenyl)methyl](cyclopentyl)carbamothioyl}-N-[2-(morpholin-4-yl)ethyl]glycinamide
Chemical Structure Depiction of
N~2~-{[(2-chlorophenyl)methyl](cyclopentyl)carbamothioyl}-N-[2-(morpholin-4-yl)ethyl]glycinamide
N~2~-{[(2-chlorophenyl)methyl](cyclopentyl)carbamothioyl}-N-[2-(morpholin-4-yl)ethyl]glycinamide
Compound characteristics
| Compound ID: | K784-5237 |
| Compound Name: | N~2~-{[(2-chlorophenyl)methyl](cyclopentyl)carbamothioyl}-N-[2-(morpholin-4-yl)ethyl]glycinamide |
| Molecular Weight: | 439.02 |
| Molecular Formula: | C21 H31 Cl N4 O2 S |
| Smiles: | C1CCC(C1)N(Cc1ccccc1[Cl])C(NCC(NCCN1CCOCC1)=O)=S |
| Stereo: | ACHIRAL |
| logP: | 3.0137 |
| logD: | 2.9664 |
| logSw: | -3.3907 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 47.565 |
| InChI Key: | APCIXIPYGXUBBH-UHFFFAOYSA-N |