N-[2-(2-chlorophenyl)ethyl]-N~2~-{cyclohexyl[(4-fluorophenyl)methyl]carbamothioyl}glycinamide
Chemical Structure Depiction of
N-[2-(2-chlorophenyl)ethyl]-N~2~-{cyclohexyl[(4-fluorophenyl)methyl]carbamothioyl}glycinamide
N-[2-(2-chlorophenyl)ethyl]-N~2~-{cyclohexyl[(4-fluorophenyl)methyl]carbamothioyl}glycinamide
Compound characteristics
| Compound ID: | K784-5268 |
| Compound Name: | N-[2-(2-chlorophenyl)ethyl]-N~2~-{cyclohexyl[(4-fluorophenyl)methyl]carbamothioyl}glycinamide |
| Molecular Weight: | 462.03 |
| Molecular Formula: | C24 H29 Cl F N3 O S |
| Smiles: | C1CCC(CC1)N(Cc1ccc(cc1)F)C(NCC(NCCc1ccccc1[Cl])=O)=S |
| Stereo: | ACHIRAL |
| logP: | 5.4962 |
| logD: | 5.4962 |
| logSw: | -5.8528 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 35.308 |
| InChI Key: | HXOVZORWISQHHL-UHFFFAOYSA-N |