N~2~-{cyclohexyl[(2-fluorophenyl)methyl]carbamothioyl}-N-(3-ethoxypropyl)glycinamide
Chemical Structure Depiction of
N~2~-{cyclohexyl[(2-fluorophenyl)methyl]carbamothioyl}-N-(3-ethoxypropyl)glycinamide
N~2~-{cyclohexyl[(2-fluorophenyl)methyl]carbamothioyl}-N-(3-ethoxypropyl)glycinamide
Compound characteristics
| Compound ID: | K784-5287 |
| Compound Name: | N~2~-{cyclohexyl[(2-fluorophenyl)methyl]carbamothioyl}-N-(3-ethoxypropyl)glycinamide |
| Molecular Weight: | 409.57 |
| Molecular Formula: | C21 H32 F N3 O2 S |
| Smiles: | CCOCCCNC(CNC(N(Cc1ccccc1F)C1CCCCC1)=S)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1677 |
| logD: | 4.1677 |
| logSw: | -3.8736 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 43.557 |
| InChI Key: | IRXKWZIJWVFUSB-UHFFFAOYSA-N |