2-{[5,6-bis(4-ethoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-ethyl-N-(3-methylphenyl)acetamide
Chemical Structure Depiction of
2-{[5,6-bis(4-ethoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-ethyl-N-(3-methylphenyl)acetamide
2-{[5,6-bis(4-ethoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-ethyl-N-(3-methylphenyl)acetamide
Compound characteristics
| Compound ID: | K784-7855 |
| Compound Name: | 2-{[5,6-bis(4-ethoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-ethyl-N-(3-methylphenyl)acetamide |
| Molecular Weight: | 528.67 |
| Molecular Formula: | C30 H32 N4 O3 S |
| Smiles: | CCN(C(CSc1nc(c2ccc(cc2)OCC)c(c2ccc(cc2)OCC)nn1)=O)c1cccc(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 6.3004 |
| logD: | 6.3004 |
| logSw: | -5.4396 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 60.724 |
| InChI Key: | CCAMNBIWULDYMG-UHFFFAOYSA-N |