N-(4-chloro-2-methoxy-5-methylphenyl)-2-{1-[(4-fluorophenyl)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}hydrazine-1-carbothioamide
Chemical Structure Depiction of
N-(4-chloro-2-methoxy-5-methylphenyl)-2-{1-[(4-fluorophenyl)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}hydrazine-1-carbothioamide
N-(4-chloro-2-methoxy-5-methylphenyl)-2-{1-[(4-fluorophenyl)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}hydrazine-1-carbothioamide
Compound characteristics
| Compound ID: | K784-9229 |
| Compound Name: | N-(4-chloro-2-methoxy-5-methylphenyl)-2-{1-[(4-fluorophenyl)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}hydrazine-1-carbothioamide |
| Molecular Weight: | 482.96 |
| Molecular Formula: | C24 H20 Cl F N4 O2 S |
| Smiles: | Cc1cc(c(cc1[Cl])OC)NC(N/N=C1C(N(Cc2ccc(cc2)F)c2ccccc/12)=O)=S |
| Stereo: | ACHIRAL |
| logP: | 6.2338 |
| logD: | 6.2335 |
| logSw: | -5.9721 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.253 |
| InChI Key: | QIJHFULHXNGMHX-UHFFFAOYSA-N |