ethyl 4-[(2-{5-bromo-1-[(2-fluorophenyl)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}hydrazinecarbothioyl)amino]benzoate
Chemical Structure Depiction of
ethyl 4-[(2-{5-bromo-1-[(2-fluorophenyl)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}hydrazinecarbothioyl)amino]benzoate
ethyl 4-[(2-{5-bromo-1-[(2-fluorophenyl)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}hydrazinecarbothioyl)amino]benzoate
Compound characteristics
| Compound ID: | K784-9376 |
| Compound Name: | ethyl 4-[(2-{5-bromo-1-[(2-fluorophenyl)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}hydrazinecarbothioyl)amino]benzoate |
| Molecular Weight: | 555.42 |
| Molecular Formula: | C25 H20 Br F N4 O3 S |
| Smiles: | CCOC(c1ccc(cc1)NC(N/N=C1C(N(Cc2ccccc2F)c2ccc(cc/12)[Br])=O)=S)=O |
| Stereo: | ACHIRAL |
| logP: | 6.7012 |
| logD: | 6.701 |
| logSw: | -5.6248 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.074 |
| InChI Key: | UASGAIZLQDNPIP-UHFFFAOYSA-N |