2-{5-bromo-1-[(2-chloro-4-fluorophenyl)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}-N-(2,6-dimethylphenyl)hydrazine-1-carbothioamide
Chemical Structure Depiction of
2-{5-bromo-1-[(2-chloro-4-fluorophenyl)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}-N-(2,6-dimethylphenyl)hydrazine-1-carbothioamide
2-{5-bromo-1-[(2-chloro-4-fluorophenyl)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}-N-(2,6-dimethylphenyl)hydrazine-1-carbothioamide
Compound characteristics
| Compound ID: | K784-9392 |
| Compound Name: | 2-{5-bromo-1-[(2-chloro-4-fluorophenyl)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}-N-(2,6-dimethylphenyl)hydrazine-1-carbothioamide |
| Molecular Weight: | 545.86 |
| Molecular Formula: | C24 H19 Br Cl F N4 O S |
| Smiles: | Cc1cccc(C)c1NC(N/N=C1C(N(Cc2ccc(cc2[Cl])F)c2ccc(cc/12)[Br])=O)=S |
| Stereo: | ACHIRAL |
| logP: | 6.9363 |
| logD: | 6.9342 |
| logSw: | -6.3517 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 43.925 |
| InChI Key: | YVADDIXLAFEEMV-UHFFFAOYSA-N |