2-(2-ethyl-6-methyl-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl)-N-(4-phenylbutan-2-yl)acetamide
Chemical Structure Depiction of
2-(2-ethyl-6-methyl-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl)-N-(4-phenylbutan-2-yl)acetamide
2-(2-ethyl-6-methyl-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl)-N-(4-phenylbutan-2-yl)acetamide
Compound characteristics
| Compound ID: | K784-9844 |
| Compound Name: | 2-(2-ethyl-6-methyl-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl)-N-(4-phenylbutan-2-yl)acetamide |
| Molecular Weight: | 380.49 |
| Molecular Formula: | C23 H28 N2 O3 |
| Smiles: | CCC1C(N(CC(NC(C)CCc2ccccc2)=O)c2cc(C)ccc2O1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.2529 |
| logD: | 4.2529 |
| logSw: | -4.2648 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.179 |
| InChI Key: | IQUFJDDSZNDEBA-UHFFFAOYSA-N |