N-cyclohexyl-2-(4-ethoxyphenyl)quinoline-4-carboxamide
Chemical Structure Depiction of
N-cyclohexyl-2-(4-ethoxyphenyl)quinoline-4-carboxamide
N-cyclohexyl-2-(4-ethoxyphenyl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | K784-9928 |
| Compound Name: | N-cyclohexyl-2-(4-ethoxyphenyl)quinoline-4-carboxamide |
| Molecular Weight: | 374.48 |
| Molecular Formula: | C24 H26 N2 O2 |
| Smiles: | CCOc1ccc(cc1)c1cc(C(NC2CCCCC2)=O)c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 6.2313 |
| logD: | 6.2312 |
| logSw: | -5.6389 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.56 |
| InChI Key: | UWCREOGTAGMBGF-UHFFFAOYSA-N |