(3,5-dimethylpiperidin-1-yl)[2-(4-ethoxyphenyl)quinolin-4-yl]methanone
Chemical Structure Depiction of
(3,5-dimethylpiperidin-1-yl)[2-(4-ethoxyphenyl)quinolin-4-yl]methanone
(3,5-dimethylpiperidin-1-yl)[2-(4-ethoxyphenyl)quinolin-4-yl]methanone
Compound characteristics
| Compound ID: | K784-9941 |
| Compound Name: | (3,5-dimethylpiperidin-1-yl)[2-(4-ethoxyphenyl)quinolin-4-yl]methanone |
| Molecular Weight: | 388.51 |
| Molecular Formula: | C25 H28 N2 O2 |
| Smiles: | CCOc1ccc(cc1)c1cc(C(N2CC(C)CC(C)C2)=O)c2ccccc2n1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 6.0314 |
| logD: | 6.0313 |
| logSw: | -5.7534 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.936 |
| InChI Key: | BFKURISOOFZEQD-UHFFFAOYSA-N |