2-(4-methoxyphenyl)-N-(1-phenylethyl)-6-(propan-2-yl)quinoline-4-carboxamide
Chemical Structure Depiction of
2-(4-methoxyphenyl)-N-(1-phenylethyl)-6-(propan-2-yl)quinoline-4-carboxamide
2-(4-methoxyphenyl)-N-(1-phenylethyl)-6-(propan-2-yl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | K786-0814 |
| Compound Name: | 2-(4-methoxyphenyl)-N-(1-phenylethyl)-6-(propan-2-yl)quinoline-4-carboxamide |
| Molecular Weight: | 424.54 |
| Molecular Formula: | C28 H28 N2 O2 |
| Smiles: | CC(C)c1ccc2c(c1)c(cc(c1ccc(cc1)OC)n2)C(NC(C)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 7.2265 |
| logD: | 7.2259 |
| logSw: | -5.864 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.418 |
| InChI Key: | YDWJWKBBBNKPQH-IBGZPJMESA-N |