N-cyclopentyl-2-(4-methoxyphenyl)-6-(propan-2-yl)quinoline-4-carboxamide
Chemical Structure Depiction of
N-cyclopentyl-2-(4-methoxyphenyl)-6-(propan-2-yl)quinoline-4-carboxamide
N-cyclopentyl-2-(4-methoxyphenyl)-6-(propan-2-yl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | K786-1034 |
| Compound Name: | N-cyclopentyl-2-(4-methoxyphenyl)-6-(propan-2-yl)quinoline-4-carboxamide |
| Molecular Weight: | 388.51 |
| Molecular Formula: | C25 H28 N2 O2 |
| Smiles: | CC(C)c1ccc2c(c1)c(cc(c1ccc(cc1)OC)n2)C(NC1CCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.8443 |
| logD: | 6.8437 |
| logSw: | -5.7877 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.346 |
| InChI Key: | YYWZHHAAHQCFPO-UHFFFAOYSA-N |