N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(4-ethoxyphenyl)methyl]-3-oxo-2,3-dihydro-1H-isoindole-1-carboxamide
Chemical Structure Depiction of
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(4-ethoxyphenyl)methyl]-3-oxo-2,3-dihydro-1H-isoindole-1-carboxamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(4-ethoxyphenyl)methyl]-3-oxo-2,3-dihydro-1H-isoindole-1-carboxamide
Compound characteristics
| Compound ID: | K786-2102 |
| Compound Name: | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(4-ethoxyphenyl)methyl]-3-oxo-2,3-dihydro-1H-isoindole-1-carboxamide |
| Molecular Weight: | 474.56 |
| Molecular Formula: | C28 H30 N2 O5 |
| Smiles: | CCOc1ccc(CN2C(C(NCCc3ccc(c(c3)OC)OC)=O)c3ccccc3C2=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2675 |
| logD: | 3.2675 |
| logSw: | -3.5739 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.928 |
| InChI Key: | PQFKWFZRALHBCF-SANMLTNESA-N |